C26H27N3O2 — CID 17061407
9-[4-(dimethylamino)phenyl]-6-(5-methylfuran-2-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 17061407) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 9-[4-(dimethylamino)phenyl]-6-(5-methylfuran-2-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 9-[4-(dimethylamino)phenyl]-6-(5-methylfuran-2-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 17061407 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 9-[4-(dimethylamino)phenyl]-6-(5-methylfuran-2-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | Cc1ccc(C2Nc3ccccc3NC3=C2C(=O)CC(c2ccc(N(C)C)cc2)C3)o1 |
| InChI | InChI=1S/C26H27N3O2/c1-16-8-13-24(31-16)26-25-22(27-20-6-4-5-7-21(20)28-26)14-18(15-23(25)30)17-9-11-19(12-10-17)29(2)3/h4-13,18,26-28H,14-15H2,1-3H3 |
| InChIKey | DNRUGAGOAXDBBS-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|