C22H17F4NO2 — CID 17060583
7-(4-fluorophenyl)-4-[2-(trifluoromethyl)phenyl]-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17060583) has the molecular formula C22H17F4NO2 and a molecular weight of 403.38 g/mol. Its IUPAC name is 7-(4-fluorophenyl)-4-[2-(trifluoromethyl)phenyl]-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 7-(4-fluorophenyl)-4-[2-(trifluoromethyl)phenyl]-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17060583 |
| Molecular Formula | C22H17F4NO2 |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 7-(4-fluorophenyl)-4-[2-(trifluoromethyl)phenyl]-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | O=C1CC(c2ccccc2C(F)(F)F)C2=C(CC(c3ccc(F)cc3)CC2=O)N1 |
| InChI | InChI=1S/C22H17F4NO2/c23-14-7-5-12(6-8-14)13-9-18-21(19(28)10-13)16(11-20(29)27-18)15-3-1-2-4-17(15)22(24,25)26/h1-8,13,16H,9-11H2,(H,27,29) |
| InChIKey | UQZUOWTUGFVROZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |