C23H21BrFNO4 — CID 17060584
4-(4-bromo-2,5-dimethoxyphenyl)-7-(4-fluorophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17060584) has the molecular formula C23H21BrFNO4 and a molecular weight of 474.33 g/mol. Its IUPAC name is 4-(4-bromo-2,5-dimethoxyphenyl)-7-(4-fluorophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 4-(4-bromo-2,5-dimethoxyphenyl)-7-(4-fluorophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17060584 |
| Molecular Formula | C23H21BrFNO4 |
| Molecular Weight | 474.33 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | 4-(4-bromo-2,5-dimethoxyphenyl)-7-(4-fluorophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | COc1cc(C2CC(=O)NC3=C2C(=O)CC(c2ccc(F)cc2)C3)c(OC)cc1Br |
| InChI | InChI=1S/C23H21BrFNO4/c1-29-20-11-17(24)21(30-2)9-15(20)16-10-22(28)26-18-7-13(8-19(27)23(16)18)12-3-5-14(25)6-4-12/h3-6,9,11,13,16H,7-8,10H2,1-2H3,(H,26,28) |
| InChIKey | MYRYHSYEPLQZLX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.33 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |