C24H23Cl2NO5 — CID 17062944
7-(3,4-dichlorophenyl)-4-(2,4,5-trimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17062944) has the molecular formula C24H23Cl2NO5 and a molecular weight of 476.36 g/mol. Its IUPAC name is 7-(3,4-dichlorophenyl)-4-(2,4,5-trimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 7-(3,4-dichlorophenyl)-4-(2,4,5-trimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17062944 |
| Molecular Formula | C24H23Cl2NO5 |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 7-(3,4-dichlorophenyl)-4-(2,4,5-trimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | COc1cc(OC)c(C2CC(=O)NC3=C2C(=O)CC(c2ccc(Cl)c(Cl)c2)C3)cc1OC |
| InChI | InChI=1S/C24H23Cl2NO5/c1-30-20-11-22(32-3)21(31-2)9-14(20)15-10-23(29)27-18-7-13(8-19(28)24(15)18)12-4-5-16(25)17(26)6-12/h4-6,9,11,13,15H,7-8,10H2,1-3H3,(H,27,29) |
| InChIKey | SVHURMURKVEVAA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |