C23H22ClNO2 — CID 17060657
7-(2-chlorophenyl)-4-(4-ethylphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17060657) has the molecular formula C23H22ClNO2 and a molecular weight of 379.89 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-4-(4-ethylphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 7-(2-chlorophenyl)-4-(4-ethylphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17060657 |
| Molecular Formula | C23H22ClNO2 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 7-(2-chlorophenyl)-4-(4-ethylphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | CCc1ccc(C2CC(=O)NC3=C2C(=O)CC(c2ccccc2Cl)C3)cc1 |
| InChI | InChI=1S/C23H22ClNO2/c1-2-14-7-9-15(10-8-14)18-13-22(27)25-20-11-16(12-21(26)23(18)20)17-5-3-4-6-19(17)24/h3-10,16,18H,2,11-13H2,1H3,(H,25,27) |
| InChIKey | WLLIDISGMFNDNF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |