C27H31NO2 — CID 17064569
7-(4-tert-butylphenyl)-4-(4-ethylphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17064569) has the molecular formula C27H31NO2 and a molecular weight of 401.55 g/mol. Its IUPAC name is 7-(4-tert-butylphenyl)-4-(4-ethylphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 7-(4-tert-butylphenyl)-4-(4-ethylphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17064569 |
| Molecular Formula | C27H31NO2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | 7-(4-tert-butylphenyl)-4-(4-ethylphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | CCc1ccc(C2CC(=O)NC3=C2C(=O)CC(c2ccc(C(C)(C)C)cc2)C3)cc1 |
| InChI | InChI=1S/C27H31NO2/c1-5-17-6-8-19(9-7-17)22-16-25(30)28-23-14-20(15-24(29)26(22)23)18-10-12-21(13-11-18)27(2,3)4/h6-13,20,22H,5,14-16H2,1-4H3,(H,28,30) |
| InChIKey | OZBJBEJMAYOUGZ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |