C31H31NO3 — CID 17065185
7-(4-tert-butylphenyl)-4-(3-phenoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17065185) has the molecular formula C31H31NO3 and a molecular weight of 465.59 g/mol. Its IUPAC name is 7-(4-tert-butylphenyl)-4-(3-phenoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 7-(4-tert-butylphenyl)-4-(3-phenoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17065185 |
| Molecular Formula | C31H31NO3 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 7-(4-tert-butylphenyl)-4-(3-phenoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | CC(C)(C)c1ccc(C2CC(=O)C3=C(C2)NC(=O)CC3c2cccc(Oc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C31H31NO3/c1-31(2,3)23-14-12-20(13-15-23)22-17-27-30(28(33)18-22)26(19-29(34)32-27)21-8-7-11-25(16-21)35-24-9-5-4-6-10-24/h4-16,22,26H,17-19H2,1-3H3,(H,32,34) |
| InChIKey | GKNGYGMAFCIBPQ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |