C22H18Cl2N2O4 — CID 17064400
7-(3,4-dichlorophenyl)-4-(4-methyl-3-nitrophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17064400) has the molecular formula C22H18Cl2N2O4 and a molecular weight of 445.30 g/mol. Its IUPAC name is 7-(3,4-dichlorophenyl)-4-(4-methyl-3-nitrophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 7-(3,4-dichlorophenyl)-4-(4-methyl-3-nitrophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17064400 |
| Molecular Formula | C22H18Cl2N2O4 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 7-(3,4-dichlorophenyl)-4-(4-methyl-3-nitrophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | Cc1ccc(C2CC(=O)NC3=C2C(=O)CC(c2ccc(Cl)c(Cl)c2)C3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H18Cl2N2O4/c1-11-2-3-13(8-19(11)26(29)30)15-10-21(28)25-18-7-14(9-20(27)22(15)18)12-4-5-16(23)17(24)6-12/h2-6,8,14-15H,7,9-10H2,1H3,(H,25,28) |
| InChIKey | VINQBKVSMJMSBP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|