C19H15Cl2NO2S — CID 7413931
(4R,7S)-4-(2,4-dichlorophenyl)-7-thiophen-2-yl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 7413931) has the molecular formula C19H15Cl2NO2S and a molecular weight of 392.31 g/mol. Its IUPAC name is (4R,7S)-4-(2,4-dichlorophenyl)-7-thiophen-2-yl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | (4R,7S)-4-(2,4-dichlorophenyl)-7-thiophen-2-yl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 7413931 |
| Molecular Formula | C19H15Cl2NO2S |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | (4R,7S)-4-(2,4-dichlorophenyl)-7-thiophen-2-yl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | O=C1C[C@@H](c2ccc(Cl)cc2Cl)C2=C(C[C@H](c3cccs3)CC2=O)N1 |
| InChI | InChI=1S/C19H15Cl2NO2S/c20-11-3-4-12(14(21)8-11)13-9-18(24)22-15-6-10(7-16(23)19(13)15)17-2-1-5-25-17/h1-5,8,10,13H,6-7,9H2,(H,22,24)/t10-,13-/m0/s1 |
| InChIKey | CJLXPQWQMWMYTE-GWCFXTLKSA-N |
| XLogP | 5.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |