C26H25N3O4 — CID 66824720
2-ethoxy-4-[5-(3-ethylphenyl)-6-phenyl-1,4-dihydropyrimidin-4-yl]-6-nitrophenol (PubChem CID 66824720) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is 2-ethoxy-4-[5-(3-ethylphenyl)-6-phenyl-1,4-dihydropyrimidin-4-yl]-6-nitrophenol.
| Compound Name | 2-ethoxy-4-[5-(3-ethylphenyl)-6-phenyl-1,4-dihydropyrimidin-4-yl]-6-nitrophenol |
|---|---|
| PubChem CID | 66824720 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 2-ethoxy-4-[5-(3-ethylphenyl)-6-phenyl-1,4-dihydropyrimidin-4-yl]-6-nitrophenol |
| SMILES | CCOc1cc(C2N=CNC(c3ccccc3)=C2c2cccc(CC)c2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C26H25N3O4/c1-3-17-9-8-12-19(13-17)23-24(18-10-6-5-7-11-18)27-16-28-25(23)20-14-21(29(31)32)26(30)22(15-20)33-4-2/h5-16,25,30H,3-4H2,1-2H3,(H,27,28) |
| InChIKey | DPYRXLOJIAQYOK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|