C19H25N3O7 — CID 110845510
methyl 4-(3,4-diethoxy-5-nitrophenyl)-2-oxo-6-propan-2-yl-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 110845510) has the molecular formula C19H25N3O7 and a molecular weight of 407.42 g/mol. Its IUPAC name is methyl 4-(3,4-diethoxy-5-nitrophenyl)-2-oxo-6-propan-2-yl-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl 4-(3,4-diethoxy-5-nitrophenyl)-2-oxo-6-propan-2-yl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 110845510 |
| Molecular Formula | C19H25N3O7 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | methyl 4-(3,4-diethoxy-5-nitrophenyl)-2-oxo-6-propan-2-yl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOc1cc(C2NC(=O)NC(C(C)C)=C2C(=O)OC)cc([N+](=O)[O-])c1OCC |
| InChI | InChI=1S/C19H25N3O7/c1-6-28-13-9-11(8-12(22(25)26)17(13)29-7-2)16-14(18(23)27-5)15(10(3)4)20-19(24)21-16/h8-10,16H,6-7H2,1-5H3,(H2,20,21,24) |
| InChIKey | FQOHOVWUOPGMOO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|