C14H15N3O7 — CID 2917100
methyl 4-(4-hydroxy-3-methoxy-5-nitrophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 2917100) has the molecular formula C14H15N3O7 and a molecular weight of 337.29 g/mol. Its IUPAC name is methyl 4-(4-hydroxy-3-methoxy-5-nitrophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl 4-(4-hydroxy-3-methoxy-5-nitrophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 2917100 |
| Molecular Formula | C14H15N3O7 |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | methyl 4-(4-hydroxy-3-methoxy-5-nitrophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)NC(=O)NC1c1cc(OC)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H15N3O7/c1-6-10(13(19)24-3)11(16-14(20)15-6)7-4-8(17(21)22)12(18)9(5-7)23-2/h4-5,11,18H,1-3H3,(H2,15,16,20) |
| InChIKey | UHYSDUWVTLGVSS-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|