C19H17ClN4O6 — CID 27087940
(4R)-N-(3-chlorophenyl)-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 27087940) has the molecular formula C19H17ClN4O6 and a molecular weight of 432.82 g/mol. Its IUPAC name is (4R)-N-(3-chlorophenyl)-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | (4R)-N-(3-chlorophenyl)-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 27087940 |
| Molecular Formula | C19H17ClN4O6 |
| Molecular Weight | 432.82 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | (4R)-N-(3-chlorophenyl)-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | COc1cc([C@H]2NC(=O)NC(C)=C2C(=O)Nc2cccc(Cl)c2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C19H17ClN4O6/c1-9-15(18(26)22-12-5-3-4-11(20)8-12)16(23-19(27)21-9)10-6-13(24(28)29)17(25)14(7-10)30-2/h3-8,16,25H,1-2H3,(H,22,26)(H2,21,23,27)/t16-/m1/s1 |
| InChIKey | BMADEUSFNLZGCW-MRXNPFEDSA-N |
| XLogP | 3.23 |
| TPSA | 142.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.82 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|