C18H14ClN5O6 — CID 25400305
(4R)-4-(4-chloro-3-nitrophenyl)-6-methyl-N-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 25400305) has the molecular formula C18H14ClN5O6 and a molecular weight of 431.79 g/mol. Its IUPAC name is (4R)-4-(4-chloro-3-nitrophenyl)-6-methyl-N-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | (4R)-4-(4-chloro-3-nitrophenyl)-6-methyl-N-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 25400305 |
| Molecular Formula | C18H14ClN5O6 |
| Molecular Weight | 431.79 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | (4R)-4-(4-chloro-3-nitrophenyl)-6-methyl-N-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2cccc([N+](=O)[O-])c2)[C@@H](c2ccc(Cl)c([N+](=O)[O-])c2)NC(=O)N1 |
| InChI | InChI=1S/C18H14ClN5O6/c1-9-15(17(25)21-11-3-2-4-12(8-11)23(27)28)16(22-18(26)20-9)10-5-6-13(19)14(7-10)24(29)30/h2-8,16H,1H3,(H,21,25)(H2,20,22,26)/t16-/m1/s1 |
| InChIKey | SWQXIIVHAJZJRE-MRXNPFEDSA-N |
| XLogP | 3.42 |
| TPSA | 156.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.79 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|