C18H15FN4O4 — CID 3976973
4-(4-fluorophenyl)-6-methyl-N-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 3976973) has the molecular formula C18H15FN4O4 and a molecular weight of 370.34 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-6-methyl-N-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-6-methyl-N-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 3976973 |
| Molecular Formula | C18H15FN4O4 |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 4-(4-fluorophenyl)-6-methyl-N-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2cccc([N+](=O)[O-])c2)C(c2ccc(F)cc2)NC(=O)N1 |
| InChI | InChI=1S/C18H15FN4O4/c1-10-15(17(24)21-13-3-2-4-14(9-13)23(26)27)16(22-18(25)20-10)11-5-7-12(19)8-6-11/h2-9,16H,1H3,(H,21,24)(H2,20,22,25) |
| InChIKey | DHLKIWQXUQDYJR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|