C21H21N3O7 — CID 110843794
propan-2-yl 4-(5-hydroxy-4-methoxy-2-nitrophenyl)-2-oxo-6-phenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 110843794) has the molecular formula C21H21N3O7 and a molecular weight of 427.41 g/mol. Its IUPAC name is propan-2-yl 4-(5-hydroxy-4-methoxy-2-nitrophenyl)-2-oxo-6-phenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 4-(5-hydroxy-4-methoxy-2-nitrophenyl)-2-oxo-6-phenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 110843794 |
| Molecular Formula | C21H21N3O7 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | propan-2-yl 4-(5-hydroxy-4-methoxy-2-nitrophenyl)-2-oxo-6-phenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | COc1cc([N+](=O)[O-])c(C2NC(=O)NC(c3ccccc3)=C2C(=O)OC(C)C)cc1O |
| InChI | InChI=1S/C21H21N3O7/c1-11(2)31-20(26)17-18(12-7-5-4-6-8-12)22-21(27)23-19(17)13-9-15(25)16(30-3)10-14(13)24(28)29/h4-11,19,25H,1-3H3,(H2,22,23,27) |
| InChIKey | TVBPGZSXHRJAEQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|