C10H11N3O5 — CID 171252740
(4S)-4-(4-hydroxy-3-methoxy-5-nitrophenyl)imidazolidin-2-one (PubChem CID 171252740) has the molecular formula C10H11N3O5 and a molecular weight of 253.21 g/mol. Its IUPAC name is (4S)-4-(4-hydroxy-3-methoxy-5-nitrophenyl)imidazolidin-2-one.
| Compound Name | (4S)-4-(4-hydroxy-3-methoxy-5-nitrophenyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 171252740 |
| Molecular Formula | C10H11N3O5 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | (4S)-4-(4-hydroxy-3-methoxy-5-nitrophenyl)imidazolidin-2-one |
| SMILES | COc1cc([C@H]2CNC(=O)N2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C10H11N3O5/c1-18-8-3-5(6-4-11-10(15)12-6)2-7(9(8)14)13(16)17/h2-3,6,14H,4H2,1H3,(H2,11,12,15)/t6-/m1/s1 |
| InChIKey | JGFSMNZMHAQQQC-ZCFIWIBFSA-N |
| XLogP | 0.66 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|