C11H12N2O6S — CID 5066152
2-(4-hydroxy-3-methoxy-5-nitrophenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 5066152) has the molecular formula C11H12N2O6S and a molecular weight of 300.29 g/mol. Its IUPAC name is 2-(4-hydroxy-3-methoxy-5-nitrophenyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-(4-hydroxy-3-methoxy-5-nitrophenyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 5066152 |
| Molecular Formula | C11H12N2O6S |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 2-(4-hydroxy-3-methoxy-5-nitrophenyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | COc1cc(C2NC(C(=O)O)CS2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C11H12N2O6S/c1-19-8-3-5(2-7(9(8)14)13(17)18)10-12-6(4-20-10)11(15)16/h2-3,6,10,12,14H,4H2,1H3,(H,15,16) |
| InChIKey | HWYBYFLJBWEJRU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|