C30H40N2O8 — CID 173291342
1-hydroxy-3-[3-[3-methoxy-2-propoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]prop-1-enyl]-1-prop-2-enylurea (PubChem CID 173291342) has the molecular formula C30H40N2O8 and a molecular weight of 556.66 g/mol. Its IUPAC name is 1-hydroxy-3-[3-[3-methoxy-2-propoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]prop-1-enyl]-1-prop-2-enylurea.
| Compound Name | 1-hydroxy-3-[3-[3-methoxy-2-propoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]prop-1-enyl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 173291342 |
| Molecular Formula | C30H40N2O8 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | 1-hydroxy-3-[3-[3-methoxy-2-propoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]prop-1-enyl]-1-prop-2-enylurea |
| SMILES | C=CCN(O)C(=O)NC=CCc1cc(C2CCC(c3cc(OC)c(OC)c(OC)c3)O2)cc(OC)c1OCCC |
| InChI | InChI=1S/C30H40N2O8/c1-7-14-32(34)30(33)31-13-9-10-20-16-21(17-25(35-3)28(20)39-15-8-2)23-11-12-24(40-23)22-18-26(36-4)29(38-6)27(19-22)37-5/h7,9,13,16-19,23-24,34H,1,8,10-12,14-15H2,2-6H3,(H,31,33) |
| InChIKey | XQTUIBHHAQUKGB-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|