C28H35NO8 — CID 54004891
N-hydroxy-N-[3-[3-methoxy-2-propoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]prop-1-ynyl]acetamide (PubChem CID 54004891) has the molecular formula C28H35NO8 and a molecular weight of 513.59 g/mol. Its IUPAC name is N-hydroxy-N-[3-[3-methoxy-2-propoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]prop-1-ynyl]acetamide.
| Compound Name | N-hydroxy-N-[3-[3-methoxy-2-propoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]prop-1-ynyl]acetamide |
|---|---|
| PubChem CID | 54004891 |
| Molecular Formula | C28H35NO8 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | N-hydroxy-N-[3-[3-methoxy-2-propoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]prop-1-ynyl]acetamide |
| SMILES | CCCOc1c(CC#CN(O)C(C)=O)cc(C2CCC(c3cc(OC)c(OC)c(OC)c3)O2)cc1OC |
| InChI | InChI=1S/C28H35NO8/c1-7-13-36-27-19(9-8-12-29(31)18(2)30)14-20(15-24(27)32-3)22-10-11-23(37-22)21-16-25(33-4)28(35-6)26(17-21)34-5/h14-17,22-23,31H,7,9-11,13H2,1-6H3 |
| InChIKey | KODYTGWJIKJIFD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|