C22H26O8 — CID 11973047
(1R,3R,3aS,4R,6S,6aS)-1,4-bis(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3,6-diol (PubChem CID 11973047) has the molecular formula C22H26O8 and a molecular weight of 418.44 g/mol. Its IUPAC name is (1R,3R,3aS,4R,6S,6aS)-1,4-bis(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3,6-diol.
| Compound Name | (1R,3R,3aS,4R,6S,6aS)-1,4-bis(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3,6-diol |
|---|---|
| PubChem CID | 11973047 |
| Molecular Formula | C22H26O8 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (1R,3R,3aS,4R,6S,6aS)-1,4-bis(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3,6-diol |
| SMILES | COc1ccc([C@@H]2O[C@H](O)[C@H]3[C@@H]2[C@H](O)O[C@H]3c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C22H26O8/c1-25-13-7-5-11(9-15(13)27-3)19-17-18(22(24)29-19)20(30-21(17)23)12-6-8-14(26-2)16(10-12)28-4/h5-10,17-24H,1-4H3/t17-,18-,19-,20-,21-,22+/m0/s1 |
| InChIKey | ZODXEYLSGARSCY-KKFDQILXSA-N |
| XLogP | 2.43 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |