C12H17NO3 — CID 82287095
2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazolidine (PubChem CID 82287095) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazolidine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 82287095 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazolidine |
| SMILES | COc1ccc(C2NCC(C)O2)cc1OC |
| InChI | InChI=1S/C12H17NO3/c1-8-7-13-12(16-8)9-4-5-10(14-2)11(6-9)15-3/h4-6,8,12-13H,7H2,1-3H3 |
| InChIKey | PJAMSZSCSCSHFX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |