C14H22N2O2 — CID 82623166
2-(3,4-dimethoxyphenyl)-1-methyl-1,4-diazepane (PubChem CID 82623166) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1-methyl-1,4-diazepane.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 82623166 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1-methyl-1,4-diazepane |
| SMILES | COc1ccc(C2CNCCCN2C)cc1OC |
| InChI | InChI=1S/C14H22N2O2/c1-16-8-4-7-15-10-12(16)11-5-6-13(17-2)14(9-11)18-3/h5-6,9,12,15H,4,7-8,10H2,1-3H3 |
| InChIKey | QQEZEOCGMUDRIR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |