C15H20N2O2 — CID 82665855
2-(7-methoxy-1-benzofuran-2-yl)-1-methyl-1,4-diazepane (PubChem CID 82665855) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-(7-methoxy-1-benzofuran-2-yl)-1-methyl-1,4-diazepane.
| Compound Name | 2-(7-methoxy-1-benzofuran-2-yl)-1-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 82665855 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2-(7-methoxy-1-benzofuran-2-yl)-1-methyl-1,4-diazepane |
| SMILES | COc1cccc2cc(C3CNCCCN3C)oc12 |
| InChI | InChI=1S/C15H20N2O2/c1-17-8-4-7-16-10-12(17)14-9-11-5-3-6-13(18-2)15(11)19-14/h3,5-6,9,12,16H,4,7-8,10H2,1-2H3 |
| InChIKey | JVSVURMSIHAOOT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |