C14H17NO3 — CID 82622924
3-(7-methoxy-1-benzofuran-2-yl)-1,4-oxazepane (PubChem CID 82622924) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 3-(7-methoxy-1-benzofuran-2-yl)-1,4-oxazepane.
| Compound Name | 3-(7-methoxy-1-benzofuran-2-yl)-1,4-oxazepane |
|---|---|
| PubChem CID | 82622924 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 3-(7-methoxy-1-benzofuran-2-yl)-1,4-oxazepane |
| SMILES | COc1cccc2cc(C3COCCCN3)oc12 |
| InChI | InChI=1S/C14H17NO3/c1-16-12-5-2-4-10-8-13(18-14(10)12)11-9-17-7-3-6-15-11/h2,4-5,8,11,15H,3,6-7,9H2,1H3 |
| InChIKey | JHFHFHACXRFJRL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |