C12H14N2O3 — CID 114764868
4-methoxy-2-morpholin-3-yl-1,3-benzoxazole (PubChem CID 114764868) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 4-methoxy-2-morpholin-3-yl-1,3-benzoxazole.
| Compound Name | 4-methoxy-2-morpholin-3-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 114764868 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 4-methoxy-2-morpholin-3-yl-1,3-benzoxazole |
| SMILES | COc1cccc2oc(C3COCCN3)nc12 |
| InChI | InChI=1S/C12H14N2O3/c1-15-9-3-2-4-10-11(9)14-12(17-10)8-7-16-6-5-13-8/h2-4,8,13H,5-7H2,1H3 |
| InChIKey | LRYIJGMOMQYTSZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |