C15H20N2O2 — CID 114764869
[2-(4-methoxy-1,3-benzoxazol-2-yl)cyclohexyl]methanamine (PubChem CID 114764869) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is [2-(4-methoxy-1,3-benzoxazol-2-yl)cyclohexyl]methanamine.
| Compound Name | [2-(4-methoxy-1,3-benzoxazol-2-yl)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 114764869 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | [2-(4-methoxy-1,3-benzoxazol-2-yl)cyclohexyl]methanamine |
| SMILES | COc1cccc2oc(C3CCCCC3CN)nc12 |
| InChI | InChI=1S/C15H20N2O2/c1-18-12-7-4-8-13-14(12)17-15(19-13)11-6-3-2-5-10(11)9-16/h4,7-8,10-11H,2-3,5-6,9,16H2,1H3 |
| InChIKey | BMJIAJDBCCSABE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |