C15H18N2O2 — CID 114764930
3-(4-methoxy-1,3-benzoxazol-2-yl)bicyclo[2.2.1]heptan-2-amine (PubChem CID 114764930) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-(4-methoxy-1,3-benzoxazol-2-yl)bicyclo[2.2.1]heptan-2-amine.
| Compound Name | 3-(4-methoxy-1,3-benzoxazol-2-yl)bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 114764930 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 3-(4-methoxy-1,3-benzoxazol-2-yl)bicyclo[2.2.1]heptan-2-amine |
| SMILES | COc1cccc2oc(C3C4CCC(C4)C3N)nc12 |
| InChI | InChI=1S/C15H18N2O2/c1-18-10-3-2-4-11-14(10)17-15(19-11)12-8-5-6-9(7-8)13(12)16/h2-4,8-9,12-13H,5-7,16H2,1H3 |
| InChIKey | JREPDMAKELAVCF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |