C14H10Br2N2O2 — CID 114764858
2,4-dibromo-6-(4-methoxy-1,3-benzoxazol-2-yl)aniline (PubChem CID 114764858) has the molecular formula C14H10Br2N2O2 and a molecular weight of 398.05 g/mol. Its IUPAC name is 2,4-dibromo-6-(4-methoxy-1,3-benzoxazol-2-yl)aniline.
| Compound Name | 2,4-dibromo-6-(4-methoxy-1,3-benzoxazol-2-yl)aniline |
|---|---|
| PubChem CID | 114764858 |
| Molecular Formula | C14H10Br2N2O2 |
| Molecular Weight | 398.05 g/mol |
| Exact Mass | 395.91 |
| IUPAC Name | 2,4-dibromo-6-(4-methoxy-1,3-benzoxazol-2-yl)aniline |
| SMILES | COc1cccc2oc(-c3cc(Br)cc(Br)c3N)nc12 |
| InChI | InChI=1S/C14H10Br2N2O2/c1-19-10-3-2-4-11-13(10)18-14(20-11)8-5-7(15)6-9(16)12(8)17/h2-6H,17H2,1H3 |
| InChIKey | MVIJHPPYCGKDQM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.05 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|