C18H20N4O3 — CID 170028225
N-[2-amino-4-(4-methoxy-1,3-benzoxazol-2-yl)phenyl]-N-(2-methylpropyl)nitrous amide (PubChem CID 170028225) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-[2-amino-4-(4-methoxy-1,3-benzoxazol-2-yl)phenyl]-N-(2-methylpropyl)nitrous amide.
| Compound Name | N-[2-amino-4-(4-methoxy-1,3-benzoxazol-2-yl)phenyl]-N-(2-methylpropyl)nitrous amide |
|---|---|
| PubChem CID | 170028225 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-[2-amino-4-(4-methoxy-1,3-benzoxazol-2-yl)phenyl]-N-(2-methylpropyl)nitrous amide |
| SMILES | COc1cccc2oc(-c3ccc(N(CC(C)C)N=O)c(N)c3)nc12 |
| InChI | InChI=1S/C18H20N4O3/c1-11(2)10-22(21-23)14-8-7-12(9-13(14)19)18-20-17-15(24-3)5-4-6-16(17)25-18/h4-9,11H,10,19H2,1-3H3 |
| InChIKey | ANBWGXZXULIZPO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|