C24H23NO6 — CID 164628353
2-(3,4-dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-benzoxazole (PubChem CID 164628353) has the molecular formula C24H23NO6 and a molecular weight of 421.45 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-benzoxazole.
| Compound Name | 2-(3,4-dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 164628353 |
| Molecular Formula | C24H23NO6 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-benzoxazole |
| SMILES | COc1ccc(-c2nc3c(-c4cc(OC)c(OC)c(OC)c4)cccc3o2)cc1OC |
| InChI | InChI=1S/C24H23NO6/c1-26-17-10-9-14(11-19(17)27-2)24-25-22-16(7-6-8-18(22)31-24)15-12-20(28-3)23(30-5)21(13-15)29-4/h6-13H,1-5H3 |
| InChIKey | QSPOWYRKQMXZKD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 72.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |