C30H30O6 — CID 174734654
1,2,3-trimethoxy-5-[2-phenyl-6-(3,4,5-trimethoxyphenyl)phenyl]benzene (PubChem CID 174734654) has the molecular formula C30H30O6 and a molecular weight of 486.56 g/mol. Its IUPAC name is 1,2,3-trimethoxy-5-[2-phenyl-6-(3,4,5-trimethoxyphenyl)phenyl]benzene.
| Compound Name | 1,2,3-trimethoxy-5-[2-phenyl-6-(3,4,5-trimethoxyphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 174734654 |
| Molecular Formula | C30H30O6 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 1,2,3-trimethoxy-5-[2-phenyl-6-(3,4,5-trimethoxyphenyl)phenyl]benzene |
| SMILES | COc1cc(-c2cccc(-c3ccccc3)c2-c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C30H30O6/c1-31-24-15-20(16-25(32-2)29(24)35-5)23-14-10-13-22(19-11-8-7-9-12-19)28(23)21-17-26(33-3)30(36-6)27(18-21)34-4/h7-18H,1-6H3 |
| InChIKey | PSUPTVCGYURJAB-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |