C18H17O4+ — CID 12986342
2-(3,4,5-trimethoxyphenyl)chromenylium (PubChem CID 12986342) has the molecular formula C18H17O4+ and a molecular weight of 297.33 g/mol. Its IUPAC name is 2-(3,4,5-trimethoxyphenyl)chromenylium.
| Compound Name | 2-(3,4,5-trimethoxyphenyl)chromenylium |
|---|---|
| PubChem CID | 12986342 |
| Molecular Formula | C18H17O4+ |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-(3,4,5-trimethoxyphenyl)chromenylium |
| SMILES | COc1cc(-c2ccc3ccccc3[o+]2)cc(OC)c1OC |
| InChI | InChI=1S/C18H17O4/c1-19-16-10-13(11-17(20-2)18(16)21-3)15-9-8-12-6-4-5-7-14(12)22-15/h4-11H,1-3H3/q+1 |
| InChIKey | YGJOLSGHHFUMHV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 38.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|