C19H19O5+ — CID 13045733
2-(3,4-dimethoxyphenyl)-5,7-dimethoxychromenylium (PubChem CID 13045733) has the molecular formula C19H19O5+ and a molecular weight of 327.36 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5,7-dimethoxychromenylium.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5,7-dimethoxychromenylium |
|---|---|
| PubChem CID | 13045733 |
| Molecular Formula | C19H19O5+ |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5,7-dimethoxychromenylium |
| SMILES | COc1cc(OC)c2ccc(-c3ccc(OC)c(OC)c3)[o+]c2c1 |
| InChI | InChI=1S/C19H19O5/c1-20-13-10-17(22-3)14-6-8-15(24-18(14)11-13)12-5-7-16(21-2)19(9-12)23-4/h5-11H,1-4H3/q+1 |
| InChIKey | BXGVBFMSUGLLQG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 48.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|