C20H21NO6 — CID 58178080
4-(3,4-dimethoxyphenyl)-3-(2,3,5-trimethoxyphenyl)-1,2-oxazole (PubChem CID 58178080) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-3-(2,3,5-trimethoxyphenyl)-1,2-oxazole.
| Compound Name | 4-(3,4-dimethoxyphenyl)-3-(2,3,5-trimethoxyphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 58178080 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-3-(2,3,5-trimethoxyphenyl)-1,2-oxazole |
| SMILES | COc1cc(OC)c(OC)c(-c2nocc2-c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C20H21NO6/c1-22-13-9-14(20(26-5)18(10-13)25-4)19-15(11-27-21-19)12-6-7-16(23-2)17(8-12)24-3/h6-11H,1-5H3 |
| InChIKey | YXPQSBOKYHCHNS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 72.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |