C19H21NNaO9P — CID 173032615
sodium;hydride;[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]phenyl] dihydrogen phosphate (PubChem CID 173032615) has the molecular formula C19H21NNaO9P and a molecular weight of 461.34 g/mol. Its IUPAC name is sodium;hydride;[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]phenyl] dihydrogen phosphate.
| Compound Name | sodium;hydride;[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 173032615 |
| Molecular Formula | C19H21NNaO9P |
| Molecular Weight | 461.34 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | sodium;hydride;[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]phenyl] dihydrogen phosphate |
| SMILES | COc1ccc(-c2conc2-c2cc(OC)c(OC)c(OC)c2)cc1OP(=O)(O)O.[H-].[Na+] |
| InChI | InChI=1S/C19H20NO9P.Na.H/c1-24-14-6-5-11(7-15(14)29-30(21,22)23)13-10-28-20-18(13)12-8-16(25-2)19(27-4)17(9-12)26-3;;/h5-10H,1-4H3,(H2,21,22,23);;/q;+1;-1 |
| InChIKey | JGOCWZMHHVTJOF-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 129.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|