C18H20N3O8P — CID 59430247
[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] dihydrogen phosphate (PubChem CID 59430247) has the molecular formula C18H20N3O8P and a molecular weight of 437.35 g/mol. Its IUPAC name is [2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] dihydrogen phosphate.
| Compound Name | [2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 59430247 |
| Molecular Formula | C18H20N3O8P |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | [2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] dihydrogen phosphate |
| SMILES | COc1ccc(-c2cnnn2-c2cc(OC)c(OC)c(OC)c2)cc1OP(=O)(O)O |
| InChI | InChI=1S/C18H20N3O8P/c1-25-14-6-5-11(7-15(14)29-30(22,23)24)13-10-19-20-21(13)12-8-16(26-2)18(28-4)17(9-12)27-3/h5-10H,1-4H3,(H2,22,23,24) |
| InChIKey | WLXLSPSAYWXKKR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 134.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|