C18H18N3O8S- — CID 59430037
[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] sulfate (PubChem CID 59430037) has the molecular formula C18H18N3O8S- and a molecular weight of 436.42 g/mol. Its IUPAC name is [2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] sulfate.
| Compound Name | [2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] sulfate |
|---|---|
| PubChem CID | 59430037 |
| Molecular Formula | C18H18N3O8S- |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | [2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] sulfate |
| SMILES | COc1ccc(-c2cnnn2-c2cc(OC)c(OC)c(OC)c2)cc1OS(=O)(=O)[O-] |
| InChI | InChI=1S/C18H19N3O8S/c1-25-14-6-5-11(7-15(14)29-30(22,23)24)13-10-19-20-21(13)12-8-16(26-2)18(28-4)17(9-12)27-3/h5-10H,1-4H3,(H,22,23,24)/p-1 |
| InChIKey | XDHZLOBQYRWBAY-UHFFFAOYSA-M |
| XLogP | 1.81 |
| TPSA | 134.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|