C23H21N3O4 — CID 25067758
1-(4-phenoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazole (PubChem CID 25067758) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is 1-(4-phenoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazole.
| Compound Name | 1-(4-phenoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazole |
|---|---|
| PubChem CID | 25067758 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 1-(4-phenoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazole |
| SMILES | COc1cc(-c2cnnn2-c2ccc(Oc3ccccc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H21N3O4/c1-27-21-13-16(14-22(28-2)23(21)29-3)20-15-24-25-26(20)17-9-11-19(12-10-17)30-18-7-5-4-6-8-18/h4-15H,1-3H3 |
| InChIKey | YANOAEQOWXNAQS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |