C20H23N3O6 — CID 59429985
1-(2,3,5-trimethoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazole (PubChem CID 59429985) has the molecular formula C20H23N3O6 and a molecular weight of 401.42 g/mol. Its IUPAC name is 1-(2,3,5-trimethoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazole.
| Compound Name | 1-(2,3,5-trimethoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazole |
|---|---|
| PubChem CID | 59429985 |
| Molecular Formula | C20H23N3O6 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 1-(2,3,5-trimethoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazole |
| SMILES | COc1cc(OC)c(OC)c(-n2nncc2-c2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C20H23N3O6/c1-24-13-9-14(19(28-5)18(10-13)27-4)23-15(11-21-22-23)12-7-16(25-2)20(29-6)17(8-12)26-3/h7-11H,1-6H3 |
| InChIKey | MZPZFLKUKPSXPO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 86.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |