C18H18N3O8P-2 — CID 59430049
[5-methoxy-2-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] phosphate (PubChem CID 59430049) has the molecular formula C18H18N3O8P-2 and a molecular weight of 435.33 g/mol. Its IUPAC name is [5-methoxy-2-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] phosphate.
| Compound Name | [5-methoxy-2-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] phosphate |
|---|---|
| PubChem CID | 59430049 |
| Molecular Formula | C18H18N3O8P-2 |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | [5-methoxy-2-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] phosphate |
| SMILES | COc1ccc(-c2cnnn2-c2cc(OC)c(OC)c(OC)c2)c(OP(=O)([O-])[O-])c1 |
| InChI | InChI=1S/C18H20N3O8P/c1-25-12-5-6-13(15(9-12)29-30(22,23)24)14-10-19-20-21(14)11-7-16(26-2)18(28-4)17(8-11)27-3/h5-10H,1-4H3,(H2,22,23,24)/p-2 |
| InChIKey | CPAZEXXXMVXBMW-UHFFFAOYSA-L |
| XLogP | 1.18 |
| TPSA | 140.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|