C12H16N4O3 — CID 56772111
[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]methanamine (PubChem CID 56772111) has the molecular formula C12H16N4O3 and a molecular weight of 264.29 g/mol. Its IUPAC name is [3-(3,4,5-trimethoxyphenyl)triazol-4-yl]methanamine.
| Compound Name | [3-(3,4,5-trimethoxyphenyl)triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 56772111 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | [3-(3,4,5-trimethoxyphenyl)triazol-4-yl]methanamine |
| SMILES | COc1cc(-n2nncc2CN)cc(OC)c1OC |
| InChI | InChI=1S/C12H16N4O3/c1-17-10-4-8(5-11(18-2)12(10)19-3)16-9(6-13)7-14-15-16/h4-5,7H,6,13H2,1-3H3 |
| InChIKey | DORQQTUIRDWBGH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |