C18H18N3O5PS-2 — CID 58066611
[5-[3-(3-methoxy-4,5-dimethylphenyl)triazol-4-yl]-2-methylsulfanylphenyl] phosphate (PubChem CID 58066611) has the molecular formula C18H18N3O5PS-2 and a molecular weight of 419.40 g/mol. Its IUPAC name is [5-[3-(3-methoxy-4,5-dimethylphenyl)triazol-4-yl]-2-methylsulfanylphenyl] phosphate.
| Compound Name | [5-[3-(3-methoxy-4,5-dimethylphenyl)triazol-4-yl]-2-methylsulfanylphenyl] phosphate |
|---|---|
| PubChem CID | 58066611 |
| Molecular Formula | C18H18N3O5PS-2 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | [5-[3-(3-methoxy-4,5-dimethylphenyl)triazol-4-yl]-2-methylsulfanylphenyl] phosphate |
| SMILES | COc1cc(-n2nncc2-c2ccc(SC)c(OP(=O)([O-])[O-])c2)cc(C)c1C |
| InChI | InChI=1S/C18H20N3O5PS/c1-11-7-14(9-16(25-3)12(11)2)21-15(10-19-20-21)13-5-6-18(28-4)17(8-13)26-27(22,23)24/h5-10H,1-4H3,(H2,22,23,24)/p-2 |
| InChIKey | AKJAJPTUQJVRCZ-UHFFFAOYSA-L |
| XLogP | 2.49 |
| TPSA | 112.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|