C18H16NNa2O5PS — CID 162022952
disodium;[4-[5-(3-methoxy-4,5-dimethylphenyl)-1,2-thiazol-4-yl]phenyl] phosphate (PubChem CID 162022952) has the molecular formula C18H16NNa2O5PS and a molecular weight of 435.35 g/mol. Its IUPAC name is disodium;[4-[5-(3-methoxy-4,5-dimethylphenyl)-1,2-thiazol-4-yl]phenyl] phosphate.
| Compound Name | disodium;[4-[5-(3-methoxy-4,5-dimethylphenyl)-1,2-thiazol-4-yl]phenyl] phosphate |
|---|---|
| PubChem CID | 162022952 |
| Molecular Formula | C18H16NNa2O5PS |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | disodium;[4-[5-(3-methoxy-4,5-dimethylphenyl)-1,2-thiazol-4-yl]phenyl] phosphate |
| SMILES | COc1cc(-c2sncc2-c2ccc(OP(=O)([O-])[O-])cc2)cc(C)c1C.[Na+].[Na+] |
| InChI | InChI=1S/C18H18NO5PS.2Na/c1-11-8-14(9-17(23-3)12(11)2)18-16(10-19-26-18)13-4-6-15(7-5-13)24-25(20,21)22;;/h4-10H,1-3H3,(H2,20,21,22);;/q;2*+1/p-2 |
| InChIKey | KMPPIBKOOFFEDT-UHFFFAOYSA-L |
| XLogP | -2.68 |
| TPSA | 94.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|