C22H23AsN2O5S — CID 87134307
CID 87134307 (PubChem CID 87134307) has the molecular formula C22H23AsN2O5S and a molecular weight of 502.42 g/mol.
| Compound Name | CID 87134307 |
|---|---|
| PubChem CID | 87134307 |
| Molecular Formula | C22H23AsN2O5S |
| Molecular Weight | 502.42 g/mol |
| Exact Mass | 502.05 |
| IUPAC Name | — |
| SMILES | COc1ccc(-c2cnsc2-c2cc(OC)c(OC)c(OC)c2)cc1NC(=O)C(C)[As] |
| InChI | InChI=1S/C22H23AsN2O5S/c1-12(23)22(26)25-16-8-13(6-7-17(16)27-2)15-11-24-31-21(15)14-9-18(28-3)20(30-5)19(10-14)29-4/h6-12H,1-5H3,(H,25,26) |
| InChIKey | NMMCOUGOPAUYLY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|