C19H18NO7S2- — CID 71172547
[2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-1,2-thiazol-4-yl]phenyl] sulfite (PubChem CID 71172547) has the molecular formula C19H18NO7S2- and a molecular weight of 436.49 g/mol. Its IUPAC name is [2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-1,2-thiazol-4-yl]phenyl] sulfite.
| Compound Name | [2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-1,2-thiazol-4-yl]phenyl] sulfite |
|---|---|
| PubChem CID | 71172547 |
| Molecular Formula | C19H18NO7S2- |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | [2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-1,2-thiazol-4-yl]phenyl] sulfite |
| SMILES | COc1ccc(-c2cnsc2-c2cc(OC)c(OC)c(OC)c2)cc1OS(=O)[O-] |
| InChI | InChI=1S/C19H19NO7S2/c1-23-14-6-5-11(7-15(14)27-29(21)22)13-10-20-28-19(13)12-8-16(24-2)18(26-4)17(9-12)25-3/h5-10H,1-4H3,(H,21,22)/p-1 |
| InChIKey | HEAPBDUHCCTWFF-UHFFFAOYSA-M |
| XLogP | 3.68 |
| TPSA | 99.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|