C22H25N3O6S — CID 66744969
3-amino-3-hydroxy-N-[2-methoxy-5-[4-(3,4,5-trimethoxyphenyl)-1,2-thiazol-5-yl]phenyl]propanamide (PubChem CID 66744969) has the molecular formula C22H25N3O6S and a molecular weight of 459.52 g/mol. Its IUPAC name is 3-amino-3-hydroxy-N-[2-methoxy-5-[4-(3,4,5-trimethoxyphenyl)-1,2-thiazol-5-yl]phenyl]propanamide.
| Compound Name | 3-amino-3-hydroxy-N-[2-methoxy-5-[4-(3,4,5-trimethoxyphenyl)-1,2-thiazol-5-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 66744969 |
| Molecular Formula | C22H25N3O6S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 3-amino-3-hydroxy-N-[2-methoxy-5-[4-(3,4,5-trimethoxyphenyl)-1,2-thiazol-5-yl]phenyl]propanamide |
| SMILES | COc1ccc(-c2sncc2-c2cc(OC)c(OC)c(OC)c2)cc1NC(=O)CC(N)O |
| InChI | InChI=1S/C22H25N3O6S/c1-28-16-6-5-12(7-15(16)25-20(27)10-19(23)26)22-14(11-24-32-22)13-8-17(29-2)21(31-4)18(9-13)30-3/h5-9,11,19,26H,10,23H2,1-4H3,(H,25,27) |
| InChIKey | ACVNAHCBRZJGFW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 125.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|