C17H12NNa2O7PS — CID 159512371
disodium;[4-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-thiazol-4-yl]phenyl] phosphate (PubChem CID 159512371) has the molecular formula C17H12NNa2O7PS and a molecular weight of 451.30 g/mol. Its IUPAC name is disodium;[4-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-thiazol-4-yl]phenyl] phosphate.
| Compound Name | disodium;[4-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-thiazol-4-yl]phenyl] phosphate |
|---|---|
| PubChem CID | 159512371 |
| Molecular Formula | C17H12NNa2O7PS |
| Molecular Weight | 451.30 g/mol |
| Exact Mass | 450.99 |
| IUPAC Name | disodium;[4-[5-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-thiazol-4-yl]phenyl] phosphate |
| SMILES | COc1cc(-c2sncc2-c2ccc(OP(=O)([O-])[O-])cc2)cc2c1OCO2.[Na+].[Na+] |
| InChI | InChI=1S/C17H14NO7PS.2Na/c1-22-14-6-11(7-15-16(14)24-9-23-15)17-13(8-18-27-17)10-2-4-12(5-3-10)25-26(19,20)21;;/h2-8H,9H2,1H3,(H2,19,20,21);;/q;2*+1/p-2 |
| InChIKey | GKRAHLDPIGQXGO-UHFFFAOYSA-L |
| XLogP | -3.57 |
| TPSA | 113.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.30 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|