C17H15N2O4S+ — CID 147004068
O-[4-[3-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-thiazol-2-ium-4-yl]phenyl]hydroxylamine (PubChem CID 147004068) has the molecular formula C17H15N2O4S+ and a molecular weight of 343.38 g/mol. Its IUPAC name is O-[4-[3-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-thiazol-2-ium-4-yl]phenyl]hydroxylamine.
| Compound Name | O-[4-[3-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-thiazol-2-ium-4-yl]phenyl]hydroxylamine |
|---|---|
| PubChem CID | 147004068 |
| Molecular Formula | C17H15N2O4S+ |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | O-[4-[3-(7-methoxy-1,3-benzodioxol-5-yl)-1,2-thiazol-2-ium-4-yl]phenyl]hydroxylamine |
| SMILES | COc1cc(-c2[nH+]scc2-c2ccc(ON)cc2)cc2c1OCO2 |
| InChI | InChI=1S/C17H14N2O4S/c1-20-14-6-11(7-15-17(14)22-9-21-15)16-13(8-24-19-16)10-2-4-12(23-18)5-3-10/h2-8H,9,18H2,1H3/p+1 |
| InChIKey | KCFBUNZPBGFJGS-UHFFFAOYSA-O |
| XLogP | 2.89 |
| TPSA | 77.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|