C17H12O5 — CID 86059964
2-(7-methoxy-1,3-benzodioxol-5-yl)chromen-4-one (PubChem CID 86059964) has the molecular formula C17H12O5 and a molecular weight of 296.28 g/mol. Its IUPAC name is 2-(7-methoxy-1,3-benzodioxol-5-yl)chromen-4-one.
| Compound Name | 2-(7-methoxy-1,3-benzodioxol-5-yl)chromen-4-one |
|---|---|
| PubChem CID | 86059964 |
| Molecular Formula | C17H12O5 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 2-(7-methoxy-1,3-benzodioxol-5-yl)chromen-4-one |
| SMILES | COc1cc(-c2cc(=O)c3ccccc3o2)cc2c1OCO2 |
| InChI | InChI=1S/C17H12O5/c1-19-15-6-10(7-16-17(15)21-9-20-16)14-8-12(18)11-4-2-3-5-13(11)22-14/h2-8H,9H2,1H3 |
| InChIKey | XYMIWTLARLBFMJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |